C20H16N4O5S — CID 122302540
4-(2,5-dioxopyrrolidin-1-yl)-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide (PubChem CID 122302540) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122302540 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)Nc2cnc(Oc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C20H16N4O5S/c25-18-10-11-19(26)24(18)15-6-8-17(9-7-15)30(27,28)23-14-12-21-20(22-13-14)29-16-4-2-1-3-5-16/h1-9,12-13,23H,10-11H2 |
| InChIKey | RBZKOLXGPXGRQF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|