C40H39ClN2O8S2 — CID 160749115
3,4-dimethoxybenzenesulfonyl chloride;3,4-dimethoxy-N-(4-phenylphenyl)benzenesulfonamide;4-phenylaniline (PubChem CID 160749115) has the molecular formula C40H39ClN2O8S2 and a molecular weight of 775.35 g/mol. Its IUPAC name is 3,4-dimethoxybenzenesulfonyl chloride;3,4-dimethoxy-N-(4-phenylphenyl)benzenesulfonamide;4-phenylaniline.
| Compound Name | 3,4-dimethoxybenzenesulfonyl chloride;3,4-dimethoxy-N-(4-phenylphenyl)benzenesulfonamide;4-phenylaniline |
|---|---|
| PubChem CID | 160749115 |
| Molecular Formula | C40H39ClN2O8S2 |
| Molecular Weight | 775.35 g/mol |
| Exact Mass | 774.18 |
| IUPAC Name | 3,4-dimethoxybenzenesulfonyl chloride;3,4-dimethoxy-N-(4-phenylphenyl)benzenesulfonamide;4-phenylaniline |
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1OC.COc1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3)cc2)cc1OC.Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO4S.C12H11N.C8H9ClO4S/c1-24-19-13-12-18(14-20(19)25-2)26(22,23)21-17-10-8-16(9-11-17)15-6-4-3-5-7-15;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-12-7-4-3-6(14(9,10)11)5-8(7)13-2/h3-14,21H,1-2H3;1-9H,13H2;3-5H,1-2H3 |
| InChIKey | RWOSDOQTNBVURZ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.35 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|