C10H14N2O — CID 3662395
5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol (PubChem CID 3662395) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol.
| Compound Name | 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol |
|---|---|
| PubChem CID | 3662395 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol |
| SMILES | NCC1(O)CCCc2ncccc21 |
| InChI | InChI=1S/C10H14N2O/c11-7-10(13)5-1-4-9-8(10)3-2-6-12-9/h2-3,6,13H,1,4-5,7,11H2 |
| InChIKey | YPXDYHZTMBUGEI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |