About 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol
5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol (PubChem CID 3662395) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol.
Molecular Properties
| Compound Name | 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol |
| PubChem CID | 3662395 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol |
| SMILES | NCC1(O)CCCc2ncccc21 |
| InChI | InChI=1S/C10H14N2O/c11-7-10(13)5-1-4-9-8(10)3-2-6-12-9/h2-3,6,13H,1,4-5,7,11H2 |
| InChIKey | YPXDYHZTMBUGEI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol?
The IUPAC name of 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol (CID 3662395) is 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol.
What is the SMILES notation for 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol?
The canonical SMILES for 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol is NCC1(O)CCCc2ncccc21.
What is the InChIKey of 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol?
The InChIKey is YPXDYHZTMBUGEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c11-7-10(13)5-1-4-9-8(10)3-2-6-12-9/h2-3,6,13H,1,4-5,7,11H2.
What are the key properties of 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol?
5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol has a molecular weight of 178.24 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-7,8-dihydro-6H-quinolin-5-ol is sourced from PubChem (CID 3662395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).