C13H19NO — CID 82024150
1-(aminomethyl)-7-ethyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 82024150) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(aminomethyl)-7-ethyl-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-(aminomethyl)-7-ethyl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 82024150 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(aminomethyl)-7-ethyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CCc1ccc2c(c1)C(O)(CN)CCC2 |
| InChI | InChI=1S/C13H19NO/c1-2-10-5-6-11-4-3-7-13(15,9-14)12(11)8-10/h5-6,8,15H,2-4,7,9,14H2,1H3 |
| InChIKey | POUDBZKLEJDZAL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |