C15H12N6O5S — CID 3662701
4-[(3-nitrophenyl)sulfonylamino]-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 3662701) has the molecular formula C15H12N6O5S and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-[(3-nitrophenyl)sulfonylamino]-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-[(3-nitrophenyl)sulfonylamino]-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 3662701 |
| Molecular Formula | C15H12N6O5S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[(3-nitrophenyl)sulfonylamino]-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H12N6O5S/c22-14(18-15-16-9-17-19-15)10-4-6-11(7-5-10)20-27(25,26)13-3-1-2-12(8-13)21(23)24/h1-9,20H,(H2,16,17,18,19,22) |
| InChIKey | SECDMUXPBBFQEJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|