C20H22N2OS — CID 3663481
N'-(cyclohexen-1-yl)-4-(phenylsulfanylmethyl)benzohydrazide (PubChem CID 3663481) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is N'-(cyclohexen-1-yl)-4-(phenylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-(cyclohexen-1-yl)-4-(phenylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 3663481 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N'-(cyclohexen-1-yl)-4-(phenylsulfanylmethyl)benzohydrazide |
| SMILES | O=C(NNC1=CCCCC1)c1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2OS/c23-20(22-21-18-7-3-1-4-8-18)17-13-11-16(12-14-17)15-24-19-9-5-2-6-10-19/h2,5-7,9-14,21H,1,3-4,8,15H2,(H,22,23) |
| InChIKey | IRLKRUNVJLUKSO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|