C20H20N2O2 — CID 36644007
2-(4-methylphenoxy)-N-(2-quinolin-8-ylethyl)acetamide (PubChem CID 36644007) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-N-(2-quinolin-8-ylethyl)acetamide.
| Compound Name | 2-(4-methylphenoxy)-N-(2-quinolin-8-ylethyl)acetamide |
|---|---|
| PubChem CID | 36644007 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(4-methylphenoxy)-N-(2-quinolin-8-ylethyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCCc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-15-7-9-18(10-8-15)24-14-19(23)21-13-11-17-5-2-4-16-6-3-12-22-20(16)17/h2-10,12H,11,13-14H2,1H3,(H,21,23) |
| InChIKey | REHQIMKRMAQMDZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |