C24H27N3O3 — CID 78836623
4-butoxy-N-[2-oxo-2-(2-quinolin-8-ylethylamino)ethyl]benzamide (PubChem CID 78836623) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-butoxy-N-[2-oxo-2-(2-quinolin-8-ylethylamino)ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-oxo-2-(2-quinolin-8-ylethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 78836623 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-butoxy-N-[2-oxo-2-(2-quinolin-8-ylethylamino)ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NCCc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-16-30-21-11-9-20(10-12-21)24(29)27-17-22(28)25-15-13-19-7-4-6-18-8-5-14-26-23(18)19/h4-12,14H,2-3,13,15-17H2,1H3,(H,25,28)(H,27,29) |
| InChIKey | RSEAWYVHNYTQDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|