C33H39NO9 — CID 3664528
2-[[4-[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]-2-phenylacetic acid (PubChem CID 3664528) has the molecular formula C33H39NO9 and a molecular weight of 593.67 g/mol. Its IUPAC name is 2-[[4-[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[4-[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 3664528 |
| Molecular Formula | C33H39NO9 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-[[4-[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoyl]amino]-2-phenylacetic acid |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(=O)CC2(C)C1CCC2(O)C(=O)COC(=O)CCC(=O)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C33H39NO9/c1-31-14-12-21(35)16-20(31)8-9-22-23-13-15-33(42,32(23,2)17-24(36)28(22)31)25(37)18-43-27(39)11-10-26(38)34-29(30(40)41)19-6-4-3-5-7-19/h3-7,16,22-23,28-29,42H,8-15,17-18H2,1-2H3,(H,34,38)(H,40,41) |
| InChIKey | BMMIHPVNURNNGG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|