C34H41NO9 — CID 44662611
2-[[4-[2-[(10R,13S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 44662611) has the molecular formula C34H41NO9 and a molecular weight of 607.70 g/mol. Its IUPAC name is 2-[[4-[2-[(10R,13S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-[2-[(10R,13S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 44662611 |
| Molecular Formula | C34H41NO9 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-[[4-[2-[(10R,13S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2C(=O)C[C@@]2(C)C1CC[C@]2(O)C(=O)COC(=O)CCC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C34H41NO9/c1-32-14-12-22(36)17-21(32)8-9-23-24-13-15-34(43,33(24,2)18-26(37)30(23)32)27(38)19-44-29(40)11-10-28(39)35-25(31(41)42)16-20-6-4-3-5-7-20/h3-7,17,23-25,30,43H,8-16,18-19H2,1-2H3,(H,35,39)(H,41,42)/t23?,24?,25?,30?,32-,33-,34-/m0/s1 |
| InChIKey | MUABOYHSDXKSFL-UAWXKJHTSA-N |
| XLogP | 3.13 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|