C24H23ClN4O4 — CID 3666065
6-amino-4-[4-[2-(4-chlorophenoxy)ethoxy]-3-ethoxyphenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 3666065) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is 6-amino-4-[4-[2-(4-chlorophenoxy)ethoxy]-3-ethoxyphenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-[4-[2-(4-chlorophenoxy)ethoxy]-3-ethoxyphenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 3666065 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 6-amino-4-[4-[2-(4-chlorophenoxy)ethoxy]-3-ethoxyphenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3n[nH]c(C)c32)ccc1OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN4O4/c1-3-30-20-12-15(22-18(13-26)23(27)33-24-21(22)14(2)28-29-24)4-9-19(20)32-11-10-31-17-7-5-16(25)6-8-17/h4-9,12,22H,3,10-11,27H2,1-2H3,(H,28,29) |
| InChIKey | RSIXHKHQFZAODC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|