C22H19ClN4O3 — CID 4036506
6-amino-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 4036506) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is 6-amino-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4036506 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 6-amino-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | Cc1[nH]nc2c1C(c1ccc(OCCOc3ccccc3Cl)cc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C22H19ClN4O3/c1-13-19-20(16(12-24)21(25)30-22(19)27-26-13)14-6-8-15(9-7-14)28-10-11-29-18-5-3-2-4-17(18)23/h2-9,20H,10-11,25H2,1H3,(H,26,27) |
| InChIKey | SBLOPJLHJQXYCP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|