C21H19FN2O4 — CID 3667938
1-acetyl-4-[(4-fluorophenyl)methyl]-3-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione (PubChem CID 3667938) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-acetyl-4-[(4-fluorophenyl)methyl]-3-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione.
| Compound Name | 1-acetyl-4-[(4-fluorophenyl)methyl]-3-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 3667938 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-acetyl-4-[(4-fluorophenyl)methyl]-3-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione |
| SMILES | COc1ccc(C=C2C(=O)N(C(C)=O)CC(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H19FN2O4/c1-14(25)23-13-20(26)24(12-16-3-7-17(22)8-4-16)19(21(23)27)11-15-5-9-18(28-2)10-6-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | GCBFMLFMOHHNQS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|