C10H17N2O3- — CID 36688063
6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoate (PubChem CID 36688063) has the molecular formula C10H17N2O3- and a molecular weight of 213.26 g/mol. Its IUPAC name is 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoate.
| Compound Name | 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoate |
|---|---|
| PubChem CID | 36688063 |
| Molecular Formula | C10H17N2O3- |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]hexanoate |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)[O-] |
| InChI | InChI=1S/C10H18N2O3/c1-7-8(12-10(15)11-7)5-3-2-4-6-9(13)14/h7-8H,2-6H2,1H3,(H,13,14)(H2,11,12,15)/p-1/t7-,8+/m0/s1 |
| InChIKey | AUTOLBMXDDTRRT-JGVFFNPUSA-M |
| XLogP | -0.24 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|