C10H19N2O4- — CID 146026637
(7R,8S)-8-azaniumyl-7-(carboxylatoamino)nonanoate (PubChem CID 146026637) has the molecular formula C10H19N2O4- and a molecular weight of 231.27 g/mol. Its IUPAC name is (7R,8S)-8-azaniumyl-7-(carboxylatoamino)nonanoate.
| Compound Name | (7R,8S)-8-azaniumyl-7-(carboxylatoamino)nonanoate |
|---|---|
| PubChem CID | 146026637 |
| Molecular Formula | C10H19N2O4- |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (7R,8S)-8-azaniumyl-7-(carboxylatoamino)nonanoate |
| SMILES | C[C@H]([NH3+])[C@@H](CCCCCC(=O)[O-])NC(=O)[O-] |
| InChI | InChI=1S/C10H20N2O4/c1-7(11)8(12-10(15)16)5-3-2-4-6-9(13)14/h7-8,12H,2-6,11H2,1H3,(H,13,14)(H,15,16)/p-1/t7-,8+/m0/s1 |
| InChIKey | OQNJZSIPDMTUAJ-JGVFFNPUSA-M |
| XLogP | -2.38 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|