C16H17ClFN3O2S — CID 36695188
[2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] N'-(furan-2-ylmethyl)carbamimidothioate (PubChem CID 36695188) has the molecular formula C16H17ClFN3O2S and a molecular weight of 369.85 g/mol. Its IUPAC name is [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] N'-(furan-2-ylmethyl)carbamimidothioate.
| Compound Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] N'-(furan-2-ylmethyl)carbamimidothioate |
|---|---|
| PubChem CID | 36695188 |
| Molecular Formula | C16H17ClFN3O2S |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] N'-(furan-2-ylmethyl)carbamimidothioate |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)CS/C(N)=N/Cc1ccco1 |
| InChI | InChI=1S/C16H17ClFN3O2S/c1-21(9-12-13(17)5-2-6-14(12)18)15(22)10-24-16(19)20-8-11-4-3-7-23-11/h2-7H,8-10H2,1H3,(H2,19,20) |
| InChIKey | XRBDSPSRCHLFAE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|