C22H14Cl3F3N2O2 — CID 3669848
N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 3669848) has the molecular formula C22H14Cl3F3N2O2 and a molecular weight of 501.72 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3669848 |
| Molecular Formula | C22H14Cl3F3N2O2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NN=Cc1cc(Cl)c(OCc2ccccc2Cl)c(Cl)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H14Cl3F3N2O2/c23-17-7-2-1-4-15(17)12-32-20-18(24)8-13(9-19(20)25)11-29-30-21(31)14-5-3-6-16(10-14)22(26,27)28/h1-11H,12H2,(H,30,31) |
| InChIKey | NTUIQTYQRZRBGU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|