About sodium pentanoate
sodium pentanoate (PubChem CID 3669864) has the molecular formula C5H9NaO2
and a molecular weight of 124.11 g/mol. Its IUPAC name is sodium pentanoate.
Molecular Properties
| Compound Name | sodium pentanoate |
| PubChem CID | 3669864 |
| Molecular Formula | C5H9NaO2 |
| Molecular Weight | 124.11 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | sodium pentanoate |
| SMILES | CCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10O2.Na/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | LHYPLJGBYPAQAK-UHFFFAOYSA-M |
| XLogP | -3.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.11 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium pentanoate?
The IUPAC name of sodium pentanoate (CID 3669864) is sodium pentanoate.
What is the SMILES notation for sodium pentanoate?
The canonical SMILES for sodium pentanoate is CCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium pentanoate?
The InChIKey is LHYPLJGBYPAQAK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O2.Na/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium pentanoate?
sodium pentanoate has a molecular weight of 124.11 g/mol, XLogP of -3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium pentanoate is sourced from PubChem (CID 3669864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).