C17H7F5N2O2 — CID 3671675
5-nitro-2-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline (PubChem CID 3671675) has the molecular formula C17H7F5N2O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 5-nitro-2-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline.
| Compound Name | 5-nitro-2-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline |
|---|---|
| PubChem CID | 3671675 |
| Molecular Formula | C17H7F5N2O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-nitro-2-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline |
| SMILES | O=[N+]([O-])c1cccc2nc(C=Cc3c(F)c(F)c(F)c(F)c3F)ccc12 |
| InChI | InChI=1S/C17H7F5N2O2/c18-13-10(14(19)16(21)17(22)15(13)20)7-5-8-4-6-9-11(23-8)2-1-3-12(9)24(25)26/h1-7H |
| InChIKey | FXRBLNNXMQZZQH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|