C21H12Cl2N2O3 — CID 3876576
2-[2-[5-(2,3-dichlorophenyl)furan-2-yl]ethenyl]-5-nitroquinoline (PubChem CID 3876576) has the molecular formula C21H12Cl2N2O3 and a molecular weight of 411.24 g/mol. Its IUPAC name is 2-[2-[5-(2,3-dichlorophenyl)furan-2-yl]ethenyl]-5-nitroquinoline.
| Compound Name | 2-[2-[5-(2,3-dichlorophenyl)furan-2-yl]ethenyl]-5-nitroquinoline |
|---|---|
| PubChem CID | 3876576 |
| Molecular Formula | C21H12Cl2N2O3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-[2-[5-(2,3-dichlorophenyl)furan-2-yl]ethenyl]-5-nitroquinoline |
| SMILES | O=[N+]([O-])c1cccc2nc(C=Cc3ccc(-c4cccc(Cl)c4Cl)o3)ccc12 |
| InChI | InChI=1S/C21H12Cl2N2O3/c22-17-4-1-3-16(21(17)23)20-12-10-14(28-20)9-7-13-8-11-15-18(24-13)5-2-6-19(15)25(26)27/h1-12H |
| InChIKey | ZFFFUGBGYDHXDP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|