C24H28ClN5O — CID 36716903
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone (PubChem CID 36716903) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
|---|---|
| PubChem CID | 36716903 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3cccc(Cl)c3)CC2)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C24H28ClN5O/c1-17-14-20(22-23(26-17)30-9-4-2-3-8-21(30)27-22)24(31)29-12-10-28(11-13-29)16-18-6-5-7-19(25)15-18/h5-7,14-15H,2-4,8-13,16H2,1H3 |
| InChIKey | AMDZTVOQKZUCLP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |