C25H30N4O2 — CID 55896888
[2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone (PubChem CID 55896888) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone.
| Compound Name | [2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
|---|---|
| PubChem CID | 55896888 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
| SMILES | COc1cccc(CC2CCCN2C(=O)c2cc(C)nc3c2nc2n3CCCCC2)c1 |
| InChI | InChI=1S/C25H30N4O2/c1-17-14-21(23-24(26-17)29-12-5-3-4-11-22(29)27-23)25(30)28-13-7-9-19(28)15-18-8-6-10-20(16-18)31-2/h6,8,10,14,16,19H,3-5,7,9,11-13,15H2,1-2H3 |
| InChIKey | QJXXIBQOSHOAAV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |