C23H19ClFNO3 — CID 3674156
2-(3-chloro-4-fluorophenyl)-6-ethenyl-7-(2-hydroxyphenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 3674156) has the molecular formula C23H19ClFNO3 and a molecular weight of 411.86 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-6-ethenyl-7-(2-hydroxyphenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-6-ethenyl-7-(2-hydroxyphenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 3674156 |
| Molecular Formula | C23H19ClFNO3 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-6-ethenyl-7-(2-hydroxyphenyl)-7a-methyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CCC2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C2(C)C1c1ccccc1O |
| InChI | InChI=1S/C23H19ClFNO3/c1-3-13-8-10-16-21(28)26(14-9-11-18(25)17(24)12-14)22(29)23(16,2)20(13)15-6-4-5-7-19(15)27/h3-9,11-12,16,20,27H,1,10H2,2H3 |
| InChIKey | GLXLMNPAUPNHNA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|