C21H30N3S+ — CID 3675764
3-(2-ethylphenyl)-1-(3-methylbutyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea (PubChem CID 3675764) has the molecular formula C21H30N3S+ and a molecular weight of 356.56 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-(3-methylbutyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-(3-methylbutyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 3675764 |
| Molecular Formula | C21H30N3S+ |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 3-(2-ethylphenyl)-1-(3-methylbutyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCC(C)C)C(C)c1cccc[nH+]1 |
| InChI | InChI=1S/C21H29N3S/c1-5-18-10-6-7-12-20(18)23-21(25)24(15-13-16(2)3)17(4)19-11-8-9-14-22-19/h6-12,14,16-17H,5,13,15H2,1-4H3,(H,23,25)/p+1 |
| InChIKey | FLBHQKXGUMTVBJ-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 29.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|