C19H26N3OS+ — CID 3675777
3-(2,6-dimethylphenyl)-1-(2-methoxyethyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea (PubChem CID 3675777) has the molecular formula C19H26N3OS+ and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-(2-methoxyethyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea.
| Compound Name | 3-(2,6-dimethylphenyl)-1-(2-methoxyethyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 3675777 |
| Molecular Formula | C19H26N3OS+ |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-(2-methoxyethyl)-1-(1-pyridin-1-ium-2-ylethyl)thiourea |
| SMILES | COCCN(C(=S)Nc1c(C)cccc1C)C(C)c1cccc[nH+]1 |
| InChI | InChI=1S/C19H25N3OS/c1-14-8-7-9-15(2)18(14)21-19(24)22(12-13-23-4)16(3)17-10-5-6-11-20-17/h5-11,16H,12-13H2,1-4H3,(H,21,24)/p+1 |
| InChIKey | XAWOJOYCVLZKMI-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 38.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|