C32H29N3O3 — CID 3679272
N-naphthalen-1-yl-2-[5-(2-phenylethynyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 3679272) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[5-(2-phenylethynyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-naphthalen-1-yl-2-[5-(2-phenylethynyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 3679272 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-naphthalen-1-yl-2-[5-(2-phenylethynyl)furan-2-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCC2(CC1)CCN(C(=O)c1ccc(C#Cc3ccccc3)o1)C2 |
| InChI | InChI=1S/C32H29N3O3/c36-30(29-16-15-26(38-29)14-13-24-7-2-1-3-8-24)35-22-19-32(23-35)17-20-34(21-18-32)31(37)33-28-12-6-10-25-9-4-5-11-27(25)28/h1-12,15-16H,17-23H2,(H,33,37) |
| InChIKey | YFJUOAKHSOWWOY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|