C29H26F2N2O3 — CID 3672244
[8-(2,6-difluoro-3-methylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-phenylethynyl)furan-2-yl]methanone (PubChem CID 3672244) has the molecular formula C29H26F2N2O3 and a molecular weight of 488.53 g/mol. Its IUPAC name is [8-(2,6-difluoro-3-methylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-phenylethynyl)furan-2-yl]methanone.
| Compound Name | [8-(2,6-difluoro-3-methylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-phenylethynyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 3672244 |
| Molecular Formula | C29H26F2N2O3 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [8-(2,6-difluoro-3-methylbenzoyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-phenylethynyl)furan-2-yl]methanone |
| SMILES | Cc1ccc(F)c(C(=O)N2CCC3(CCN(C(=O)c4ccc(C#Cc5ccccc5)o4)C3)CC2)c1F |
| InChI | InChI=1S/C29H26F2N2O3/c1-20-7-11-23(30)25(26(20)31)28(35)32-16-13-29(14-17-32)15-18-33(19-29)27(34)24-12-10-22(36-24)9-8-21-5-3-2-4-6-21/h2-7,10-12H,13-19H2,1H3 |
| InChIKey | MMHGAVAYUMSVBV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|