C29H30N4O2 — CID 3682138
N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide (PubChem CID 3682138) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide.
| Compound Name | N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide |
|---|---|
| PubChem CID | 3682138 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide |
| SMILES | Cc1cccc(-n2nc(C)c(-c3ccccc3)c2NC(=O)CCCC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C29H30N4O2/c1-21-11-9-16-25(19-21)33-29(28(22(2)32-33)24-14-7-4-8-15-24)31-27(35)18-10-17-26(34)30-20-23-12-5-3-6-13-23/h3-9,11-16,19H,10,17-18,20H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | SZKJSLFXJXBCIO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |