About N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide
N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide (PubChem CID 3682138) has the molecular formula C29H30N4O2
and a molecular weight of 466.59 g/mol. Its IUPAC name is N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide.
Molecular Properties
| Compound Name | N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide |
| PubChem CID | 3682138 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide |
| SMILES | Cc1cccc(-n2nc(C)c(-c3ccccc3)c2NC(=O)CCCC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C29H30N4O2/c1-21-11-9-16-25(19-21)33-29(28(22(2)32-33)24-14-7-4-8-15-24)31-27(35)18-10-17-26(34)30-20-23-12-5-3-6-13-23/h3-9,11-16,19H,10,17-18,20H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | SZKJSLFXJXBCIO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide?
The IUPAC name of N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide (CID 3682138) is N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide.
What is the SMILES notation for N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide?
The canonical SMILES for N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide is Cc1cccc(-n2nc(C)c(-c3ccccc3)c2NC(=O)CCCC(=O)NCc2ccccc2)c1.
What is the InChIKey of N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide?
The InChIKey is SZKJSLFXJXBCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N4O2/c1-21-11-9-16-25(19-21)33-29(28(22(2)32-33)24-14-7-4-8-15-24)31-27(35)18-10-17-26(34)30-20-23-12-5-3-6-13-23/h3-9,11-16,19H,10,17-18,20H2,1-2H3,(H,30,34)(H,31,35).
What are the key properties of N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide?
N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide has a molecular weight of 466.59 g/mol, XLogP of 5.58, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]pentanediamide is sourced from PubChem (CID 3682138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).