C29H30N4O2 — CID 4311371
N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]-N-(4-methylphenyl)pentanediamide (PubChem CID 4311371) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]-N-(4-methylphenyl)pentanediamide.
| Compound Name | N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]-N-(4-methylphenyl)pentanediamide |
|---|---|
| PubChem CID | 4311371 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N'-[3-methyl-1-(3-methylphenyl)-4-phenylpyrazol-5-yl]-N-(4-methylphenyl)pentanediamide |
| SMILES | Cc1ccc(NC(=O)CCCC(=O)Nc2c(-c3ccccc3)c(C)nn2-c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H30N4O2/c1-20-15-17-24(18-16-20)30-26(34)13-8-14-27(35)31-29-28(23-10-5-4-6-11-23)22(3)32-33(29)25-12-7-9-21(2)19-25/h4-7,9-12,15-19H,8,13-14H2,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | RLMYZIKQYRRBNL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |