C20H21N3O3S2 — CID 36843860
N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 36843860) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 36843860 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-thiophen-3-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=O)c2csc(-c3ccsc3)n2)c1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-12(2)15-5-4-13(3)8-17(15)26-9-18(24)22-23-19(25)16-11-28-20(21-16)14-6-7-27-10-14/h4-8,10-12H,9H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | UXAGNSRBPYQPPB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|