C17H11Cl2N3O4S2 — CID 3685529
2,4-dichloro-N-[2-[(3-nitro-2-pyridinyl)sulfanyl]phenyl]benzenesulfonamide (PubChem CID 3685529) has the molecular formula C17H11Cl2N3O4S2 and a molecular weight of 456.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(3-nitro-2-pyridinyl)sulfanyl]phenyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[2-[(3-nitro-2-pyridinyl)sulfanyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3685529 |
| Molecular Formula | C17H11Cl2N3O4S2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | 2,4-dichloro-N-[2-[(3-nitro-2-pyridinyl)sulfanyl]phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccnc1Sc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2N3O4S2/c18-11-7-8-16(12(19)10-11)28(25,26)21-13-4-1-2-6-15(13)27-17-14(22(23)24)5-3-9-20-17/h1-10,21H |
| InChIKey | QKOJFLGMDDOMLK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|