C17H13N3O5 — CID 3687310
2-(2-methoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (PubChem CID 3687310) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
| Compound Name | 2-(2-methoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
|---|---|
| PubChem CID | 3687310 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| SMILES | COc1ccccc1C1OC2=C(Nc3ccc([N+](=O)[O-])cc3N2)C1=O |
| InChI | InChI=1S/C17H13N3O5/c1-24-13-5-3-2-4-10(13)16-15(21)14-17(25-16)19-12-8-9(20(22)23)6-7-11(12)18-14/h2-8,16,18-19H,1H3 |
| InChIKey | COQZWJMCORLEPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|