C19H22BrN2O2+ — CID 3687549
4-bromo-2-[6-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydro-1H-pyrimidin-3-ium-4-yl]phenol (PubChem CID 3687549) has the molecular formula C19H22BrN2O2+ and a molecular weight of 390.30 g/mol. Its IUPAC name is 4-bromo-2-[6-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydro-1H-pyrimidin-3-ium-4-yl]phenol.
| Compound Name | 4-bromo-2-[6-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydro-1H-pyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 3687549 |
| Molecular Formula | C19H22BrN2O2+ |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-bromo-2-[6-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydro-1H-pyrimidin-3-ium-4-yl]phenol |
| SMILES | COc1cccc(C2=CC(c3cc(Br)ccc3O)[NH2+]C(C)(C)N2)c1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-19(2)21-16(12-5-4-6-14(9-12)24-3)11-17(22-19)15-10-13(20)7-8-18(15)23/h4-11,17,21-23H,1-3H3/p+1 |
| InChIKey | PVIBUKWDTRBXPZ-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|