C22H20N2O3 — CID 3690385
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-cyano-3-phenylprop-2-enoate (PubChem CID 3690385) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-cyano-3-phenylprop-2-enoate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3690385 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-cyano-3-phenylprop-2-enoate |
| SMILES | N#CC(=Cc1ccccc1)C(=O)OCC(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C22H20N2O3/c23-14-18(13-16-7-2-1-3-8-16)22(26)27-15-21(25)24-20-12-6-10-17-9-4-5-11-19(17)20/h1-5,7-9,11,13,20H,6,10,12,15H2,(H,24,25) |
| InChIKey | NBSZFRCAGPEMML-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|