C24H24FNO2S — CID 36906839
2-(2-benzhydryloxyethylsulfanyl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 36906839) has the molecular formula C24H24FNO2S and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(2-benzhydryloxyethylsulfanyl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2-benzhydryloxyethylsulfanyl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 36906839 |
| Molecular Formula | C24H24FNO2S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-(2-benzhydryloxyethylsulfanyl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CSCCOC(c1ccccc1)c1ccccc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FNO2S/c25-22-13-11-19(12-14-22)17-26-23(27)18-29-16-15-28-24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,24H,15-18H2,(H,26,27) |
| InChIKey | PLHRLJWZVHTBCN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|