C15H12F3N3O2S2 — CID 3691139
N-(1-methyl-3-thiophen-2-ylpyrazol-5-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 3691139) has the molecular formula C15H12F3N3O2S2 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-(1-methyl-3-thiophen-2-ylpyrazol-5-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(1-methyl-3-thiophen-2-ylpyrazol-5-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3691139 |
| Molecular Formula | C15H12F3N3O2S2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-(1-methyl-3-thiophen-2-ylpyrazol-5-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cn1nc(-c2cccs2)cc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N3O2S2/c1-21-14(9-12(19-21)13-6-3-7-24-13)20-25(22,23)11-5-2-4-10(8-11)15(16,17)18/h2-9,20H,1H3 |
| InChIKey | MJKGNEZLZKVLSB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |