C11H13N3O2S2 — CID 43090486
1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpyrazol-5-amine (PubChem CID 43090486) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpyrazol-5-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 43090486 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpyrazol-5-amine |
| SMILES | Nc1cc(-c2cccs2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13N3O2S2/c12-11-6-9(10-2-1-4-17-10)13-14(11)8-3-5-18(15,16)7-8/h1-2,4,6,8H,3,5,7,12H2 |
| InChIKey | KTZNAYRHOIHDHB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |