C14H17N3O4S2 — CID 17015962
N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]methanesulfonamide (PubChem CID 17015962) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]methanesulfonamide.
| Compound Name | N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 17015962 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccccc2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17N3O4S2/c1-22(18,19)16-14-9-13(11-5-3-2-4-6-11)15-17(14)12-7-8-23(20,21)10-12/h2-6,9,12,16H,7-8,10H2,1H3 |
| InChIKey | GDFNBYRNRLTMKD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |