About 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide
6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide (PubChem CID 36917170) has the molecular formula C21H19F3N2O2
and a molecular weight of 388.39 g/mol. Its IUPAC name is 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide |
| PubChem CID | 36917170 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide |
| SMILES | COc1ccc2nc(C)c(C(=O)N(C)Cc3ccc(C(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-13-18(11-15-10-17(28-3)8-9-19(15)25-13)20(27)26(2)12-14-4-6-16(7-5-14)21(22,23)24/h4-11H,12H2,1-3H3 |
| InChIKey | ALGXROILCFENKK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide?
The IUPAC name of 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide (CID 36917170) is 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide.
What is the SMILES notation for 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide?
The canonical SMILES for 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide is COc1ccc2nc(C)c(C(=O)N(C)Cc3ccc(C(F)(F)F)cc3)cc2c1.
What is the InChIKey of 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide?
The InChIKey is ALGXROILCFENKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O2/c1-13-18(11-15-10-17(28-3)8-9-19(15)25-13)20(27)26(2)12-14-4-6-16(7-5-14)21(22,23)24/h4-11H,12H2,1-3H3.
What are the key properties of 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide?
6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide has a molecular weight of 388.39 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxamide is sourced from PubChem (CID 36917170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).