C28H24N5O5+ — CID 3692856
N-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 3692856) has the molecular formula C28H24N5O5+ and a molecular weight of 510.53 g/mol. Its IUPAC name is N-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 3692856 |
| Molecular Formula | C28H24N5O5+ |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | N-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2C=NNC(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C28H23N5O5/c1-2-28(37)21-12-23-25-19(14-33(23)26(35)20(21)16-38-27(28)36)18(17-8-4-5-9-22(17)30-25)13-29-31-24(34)15-32-10-6-3-7-11-32/h3-13,37H,2,14-16H2,1H3/p+1 |
| InChIKey | CEKUYQLSMADGKF-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|