C33H26N4O4S2 — CID 11376964
(19S)-10-[[4-[(4-aminophenyl)disulfanyl]phenyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 11376964) has the molecular formula C33H26N4O4S2 and a molecular weight of 606.73 g/mol. Its IUPAC name is (19S)-10-[[4-[(4-aminophenyl)disulfanyl]phenyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10-[[4-[(4-aminophenyl)disulfanyl]phenyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 11376964 |
| Molecular Formula | C33H26N4O4S2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | (19S)-10-[[4-[(4-aminophenyl)disulfanyl]phenyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2/C=N/c1ccc(SSc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C33H26N4O4S2/c1-2-33(40)27-15-29-30-25(17-37(29)31(38)26(27)18-41-32(33)39)24(23-5-3-4-6-28(23)36-30)16-35-20-9-13-22(14-10-20)43-42-21-11-7-19(34)8-12-21/h3-16,40H,2,17-18,34H2,1H3/b35-16+/t33-/m0/s1 |
| InChIKey | QVEJORJKNNXILJ-FBGXRPBESA-N |
| XLogP | 6.21 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|