C31H40N6O4 — CID 57054922
(19S)-10-[[3,7-diamino-3-(3-aminopropyl)heptyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 57054922) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is (19S)-10-[[3,7-diamino-3-(3-aminopropyl)heptyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10-[[3,7-diamino-3-(3-aminopropyl)heptyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 57054922 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (19S)-10-[[3,7-diamino-3-(3-aminopropyl)heptyl]iminomethyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2/C=N/CCC(N)(CCCN)CCCCN |
| InChI | InChI=1S/C31H40N6O4/c1-2-31(40)24-16-26-27-22(18-37(26)28(38)23(24)19-41-29(31)39)21(20-8-3-4-9-25(20)36-27)17-35-15-12-30(34,11-7-14-33)10-5-6-13-32/h3-4,8-9,16-17,40H,2,5-7,10-15,18-19,32-34H2,1H3/b35-17+/t30?,31-/m0/s1 |
| InChIKey | ZJCBFFSLSIMYDJ-HSEDOPMLSA-N |
| XLogP | 2.45 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|