C8H14N4S — CID 3692902
1-(3-imidazol-1-ylpropyl)-3-methylthiourea (PubChem CID 3692902) has the molecular formula C8H14N4S and a molecular weight of 198.30 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-methylthiourea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-methylthiourea |
|---|---|
| PubChem CID | 3692902 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-methylthiourea |
| SMILES | CNC(=S)NCCCn1ccnc1 |
| InChI | InChI=1S/C8H14N4S/c1-9-8(13)11-3-2-5-12-6-4-10-7-12/h4,6-7H,2-3,5H2,1H3,(H2,9,11,13) |
| InChIKey | IKGBJMGGNGHTRK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|