C13H22N6S2 — CID 118705655
3-imidazol-1-ylpropan-1-amine;3-imidazol-1-ylpropylcarbamodithioic acid (PubChem CID 118705655) has the molecular formula C13H22N6S2 and a molecular weight of 326.50 g/mol. Its IUPAC name is 3-imidazol-1-ylpropan-1-amine;3-imidazol-1-ylpropylcarbamodithioic acid.
| Compound Name | 3-imidazol-1-ylpropan-1-amine;3-imidazol-1-ylpropylcarbamodithioic acid |
|---|---|
| PubChem CID | 118705655 |
| Molecular Formula | C13H22N6S2 |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-imidazol-1-ylpropan-1-amine;3-imidazol-1-ylpropylcarbamodithioic acid |
| SMILES | NCCCn1ccnc1.S=C(S)NCCCn1ccnc1 |
| InChI | InChI=1S/C7H11N3S2.C6H11N3/c11-7(12)9-2-1-4-10-5-3-8-6-10;7-2-1-4-9-5-3-8-6-9/h3,5-6H,1-2,4H2,(H2,9,11,12);3,5-6H,1-2,4,7H2 |
| InChIKey | RRZFGRRUEJHHRW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|