C11H18N6S — CID 3048645
1-[2-(4,5-dihydroimidazol-1-yl)ethyl]-3-(2-imidazol-1-ylethyl)thiourea (PubChem CID 3048645) has the molecular formula C11H18N6S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-[2-(4,5-dihydroimidazol-1-yl)ethyl]-3-(2-imidazol-1-ylethyl)thiourea.
| Compound Name | 1-[2-(4,5-dihydroimidazol-1-yl)ethyl]-3-(2-imidazol-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 3048645 |
| Molecular Formula | C11H18N6S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[2-(4,5-dihydroimidazol-1-yl)ethyl]-3-(2-imidazol-1-ylethyl)thiourea |
| SMILES | S=C(NCCN1C=NCC1)NCCn1ccnc1 |
| InChI | InChI=1S/C11H18N6S/c18-11(14-3-7-16-5-1-12-9-16)15-4-8-17-6-2-13-10-17/h1,5,9-10H,2-4,6-8H2,(H2,14,15,18) |
| InChIKey | QLHKEMAZWZHBLY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|