C19H17N3O2 — CID 3692959
N-(9H-fluoren-9-yl)-2-(methylaminomethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3692959) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-(9H-fluoren-9-yl)-2-(methylaminomethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(9H-fluoren-9-yl)-2-(methylaminomethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3692959 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-(9H-fluoren-9-yl)-2-(methylaminomethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CNCc1nc(C(=O)NC2c3ccccc3-c3ccccc32)co1 |
| InChI | InChI=1S/C19H17N3O2/c1-20-10-17-21-16(11-24-17)19(23)22-18-14-8-4-2-6-12(14)13-7-3-5-9-15(13)18/h2-9,11,18,20H,10H2,1H3,(H,22,23) |
| InChIKey | APIQAVSOQYZSOV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |