C26H23N3O2 — CID 3693132
2-[2-(4-methoxyphenyl)-5,6-diphenylimidazo[1,2-a]imidazol-1-yl]ethanol (PubChem CID 3693132) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-5,6-diphenylimidazo[1,2-a]imidazol-1-yl]ethanol.
| Compound Name | 2-[2-(4-methoxyphenyl)-5,6-diphenylimidazo[1,2-a]imidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 3693132 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-5,6-diphenylimidazo[1,2-a]imidazol-1-yl]ethanol |
| SMILES | COc1ccc(-c2cn3c(-c4ccccc4)c(-c4ccccc4)nc3n2CCO)cc1 |
| InChI | InChI=1S/C26H23N3O2/c1-31-22-14-12-19(13-15-22)23-18-29-25(21-10-6-3-7-11-21)24(20-8-4-2-5-9-20)27-26(29)28(23)16-17-30/h2-15,18,30H,16-17H2,1H3 |
| InChIKey | LPUBXMBXJSSDKE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |