C24H30N2OS2 — CID 3695028
2-hexylsulfanyl-5-methyl-3-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3695028) has the molecular formula C24H30N2OS2 and a molecular weight of 426.65 g/mol. Its IUPAC name is 2-hexylsulfanyl-5-methyl-3-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-hexylsulfanyl-5-methyl-3-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3695028 |
| Molecular Formula | C24H30N2OS2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-hexylsulfanyl-5-methyl-3-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCSc1nc2sc3c(c2c(=O)n1-c1ccc(C)cc1)C(C)CCC3 |
| InChI | InChI=1S/C24H30N2OS2/c1-4-5-6-7-15-28-24-25-22-21(20-17(3)9-8-10-19(20)29-22)23(27)26(24)18-13-11-16(2)12-14-18/h11-14,17H,4-10,15H2,1-3H3 |
| InChIKey | AMIVHAIFHNGABY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|