C16H18FN3O — CID 36962482
1-[2-(3-fluorophenyl)ethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea (PubChem CID 36962482) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 36962482 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)NCCc1cccc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C16H18FN3O/c1-12(15-7-2-3-9-18-15)20-16(21)19-10-8-13-5-4-6-14(17)11-13/h2-7,9,11-12H,8,10H2,1H3,(H2,19,20,21)/t12-/m0/s1 |
| InChIKey | AOELDOLTWBZLMY-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |