C20H15N3O3 — CID 36979873
3-[2-[(E)-2-(3-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]propanoic acid (PubChem CID 36979873) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-[2-[(E)-2-(3-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]propanoic acid.
| Compound Name | 3-[2-[(E)-2-(3-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 36979873 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-[2-[(E)-2-(3-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]propanoic acid |
| SMILES | N#Cc1cccc(/C=C/c2nc3ccccc3c(=O)n2CCC(=O)O)c1 |
| InChI | InChI=1S/C20H15N3O3/c21-13-15-5-3-4-14(12-15)8-9-18-22-17-7-2-1-6-16(17)20(26)23(18)11-10-19(24)25/h1-9,12H,10-11H2,(H,24,25)/b9-8+ |
| InChIKey | XTOBCUOMQXVHFP-CMDGGOBGSA-N |
| XLogP | 2.91 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |